SQ 28853
Modify Date: 2025-10-05 11:50:19
SQ 28853 structure
|
Common Name | SQ 28853 | ||
|---|---|---|---|---|
| CAS Number | 107550-68-5 | Molecular Weight | 560.05 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H25ClN4NaO6S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SQ 28853SQ 28853 is an inhibitor of ACE with diuretic properties. |
| Name | SQ 28853 |
|---|
| Description | SQ 28853 is an inhibitor of ACE with diuretic properties. |
|---|---|
| References | 1. DeForrest JM, Waldron TL, Powell JR, Floyd DM, Sundeen JE. SQ 27,786 and SQ 28,853: two angiotensin converting enzyme inhibitors with potent diuretic activity. J Cardiovasc Pharmacol. 1987 Feb;9(2):154-9. PubMed PMID: 2435992. |
| Molecular Formula | C19H25ClN4NaO6S3 |
|---|---|
| Molecular Weight | 560.05 |
| InChIKey | GCQIUSPLZKYQEO-ZUEGONOJSA-M |
| SMILES | CC(CS)C(=O)N1CC(SCCC2NC(=O)c3cc(S(N)(=O)=O)c(Cl)cc3N2)CC1C(=O)[O-].[Na+] |