1-(4-Trifluoromethyl-thiazol-2-yl)-piperazine structure
|
Common Name | 1-(4-Trifluoromethyl-thiazol-2-yl)-piperazine | ||
|---|---|---|---|---|
| CAS Number | 107507-53-9 | Molecular Weight | 237.24500 | |
| Density | 1.363g/cm3 | Boiling Point | 300.3ºC at 760mmHg | |
| Molecular Formula | C8H10F3N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.4ºC | |
| Name | 2-piperazin-1-yl-4-(trifluoromethyl)-1,3-thiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.363g/cm3 |
|---|---|
| Boiling Point | 300.3ºC at 760mmHg |
| Molecular Formula | C8H10F3N3S |
| Molecular Weight | 237.24500 |
| Flash Point | 135.4ºC |
| Exact Mass | 237.05500 |
| PSA | 56.40000 |
| LogP | 1.96530 |
| Vapour Pressure | 0.00113mmHg at 25°C |
| Index of Refraction | 1.501 |
| InChIKey | WKUALTYNBYXZGQ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1csc(N2CCNCC2)n1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| qc-6199 |