1-(4-bromophenyl)-5-phenylpent-4-yne-1,3-dione structure
|
Common Name | 1-(4-bromophenyl)-5-phenylpent-4-yne-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 107451-80-9 | Molecular Weight | 327.17200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H11BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-bromophenyl)-5-phenylpent-4-yne-1,3-dione |
|---|
| Molecular Formula | C17H11BrO2 |
|---|---|
| Molecular Weight | 327.17200 |
| Exact Mass | 325.99400 |
| PSA | 34.14000 |
| LogP | 3.64270 |
| InChIKey | UGFYHQLEFIIJIX-UHFFFAOYSA-N |
| SMILES | O=C(C#Cc1ccccc1)CC(=O)c1ccc(Br)cc1 |
|
~%
1-(4-bromopheny... CAS#:107451-80-9 |
| Literature: Soliman; El-Kholy Journal of the Chemical Society, 1954 , p. 1755,1759 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |