Demethylzeylasteral structure
|
Common Name | Demethylzeylasteral | ||
|---|---|---|---|---|
| CAS Number | 107316-88-1 | Molecular Weight | 480.592 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 663.6±55.0 °C at 760 mmHg | |
| Molecular Formula | C29H36O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 369.1±28.0 °C | |
Use of DemethylzeylasteralDemethylzeylasteral is a triterpene compound isolated from Tripterygium wilfordii Hook F, with anti-inflammatory, immunosuppressive and anti-tumor activities[1][2][3][4][5]. Demethylzeylasteral can significantly alleviates atherosclerosis (AS)[5]. Demethylzeylasteral inhibits triple-negative breast cancer invasion by blocking the canonical and non-canonical TGF-β signaling pathways[2]. |
| Name | demethylzeylasteral |
|---|---|
| Synonym | More Synonyms |
| Description | Demethylzeylasteral is a triterpene compound isolated from Tripterygium wilfordii Hook F, with anti-inflammatory, immunosuppressive and anti-tumor activities[1][2][3][4][5]. Demethylzeylasteral can significantly alleviates atherosclerosis (AS)[5]. Demethylzeylasteral inhibits triple-negative breast cancer invasion by blocking the canonical and non-canonical TGF-β signaling pathways[2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 663.6±55.0 °C at 760 mmHg |
| Molecular Formula | C29H36O6 |
| Molecular Weight | 480.592 |
| Flash Point | 369.1±28.0 °C |
| Exact Mass | 480.251190 |
| PSA | 111.90000 |
| LogP | 6.90 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | ZDZSFWLPCFRASW-CPISFEQASA-N |
| SMILES | CC1(C(=O)O)CCC2(C)CCC3(C)C4=CC(=O)c5c(cc(O)c(O)c5C=O)C4(C)CCC3(C)C2C1 |
| Storage condition | 2-8C |
| (2R,4aS,6aS,12bR,14aS,14bR)-9-Formyl-10,11-dihydroxy-2,4a,6a,12b,14a-pentamethyl-8-oxo-1,2,3,4,4a,5,6,6a,8,12b,13,14,14a,14b-tetradecahydro-2-picenecarboxylic acid |
| 2-Picenecarboxylic acid, 9-formyl-1,2,3,4,4a,5,6,6a,8,12b,13,14,14a,14b-tetradecahydro-10,11-dihydroxy-2,4a,6a,12b,14a-pentamethyl-8-oxo-, (2R,4aS,6aS,12bR,14aS,14bR)- |
| Demethylzeylasteral |