7-ACETYL-1-TETRALONE
Modify Date: 2025-09-18 09:56:19
7-ACETYL-1-TETRALONE structure
|
Common Name | 7-ACETYL-1-TETRALONE | ||
|---|---|---|---|---|
| CAS Number | 106949-28-4 | Molecular Weight | 188.22200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-acetyl-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12O2 |
|---|---|
| Molecular Weight | 188.22200 |
| Exact Mass | 188.08400 |
| PSA | 34.14000 |
| LogP | 2.40820 |
| InChIKey | PLPNYENRAVFTSF-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc2c(c1)C(=O)CCC2 |
| HS Code | 2914399090 |
|---|
|
~88%
7-ACETYL-1-TETRALONE CAS#:106949-28-4 |
| Literature: Vercouillie, Johnny; Abarbri, Mohamed; Parrain, Jean-Luc; Duchene, Alain; Thibonnet, Jerome Synthetic Communications, 2004 , vol. 34, # 20 p. 3751 - 3762 |
|
~%
7-ACETYL-1-TETRALONE CAS#:106949-28-4 |
| Literature: Baddeley; Williamson Journal of the Chemical Society, 1956 , p. 4647,3652 |
|
~%
7-ACETYL-1-TETRALONE CAS#:106949-28-4 |
| Literature: Baddeley; Williamson Journal of the Chemical Society, 1956 , p. 4647,3652 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914399090 |
|---|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 1(2H)-Naphthalenone,7-acetyl-3,4-dihydro |
| 7-Acetyl-3,4-dihydro-2H-naphthalin-1-on |
| 2'-Acetonaphthone,5',6',7',8'-tetrahydro-8'-oxo-(6CI) |