1-phenyl-2-[2,3,5,6-tetramethyl-4-(2-oxo-2-phenylacetyl)phenyl]ethane-1,2-dione structure
|
Common Name | 1-phenyl-2-[2,3,5,6-tetramethyl-4-(2-oxo-2-phenylacetyl)phenyl]ethane-1,2-dione | ||
|---|---|---|---|---|
| CAS Number | 106877-53-6 | Molecular Weight | 398.45000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-phenyl-2-[2,3,5,6-tetramethyl-4-(2-oxo-2-phenylacetyl)phenyl]ethane-1,2-dione |
|---|
| Molecular Formula | C26H22O4 |
|---|---|
| Molecular Weight | 398.45000 |
| Exact Mass | 398.15200 |
| PSA | 68.28000 |
| LogP | 5.05140 |
| InChIKey | PJXZTLDBNPQXNE-UHFFFAOYSA-N |
| SMILES | Cc1c(C)c(C(=O)C(=O)c2ccccc2)c(C)c(C)c1C(=O)C(=O)c1ccccc1 |
|
~60%
1-phenyl-2-[2,3... CAS#:106877-53-6 |
| Literature: Karpitskaya, L. G.; Vasil'eva, V. P.; Merkushev, E. B. Journal of Organic Chemistry USSR (English Translation), 1991 , vol. 27, # 9.2 p. 1732 - 1736 Zhurnal Organicheskoi Khimii, 1991 , vol. 27, # 9 p. 1961 - 1965 |
|
~%
1-phenyl-2-[2,3... CAS#:106877-53-6 |
| Literature: Yusubov; Zholobova; Vasil'eva; Habicher; Filimonov Russian Journal of Organic Chemistry, 1996 , vol. 32, # 8 p. 1233 - 1234 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |