4-Acridinecarboxamide, N-(4-(dimethylamino)butyl)- structure
|
Common Name | 4-Acridinecarboxamide, N-(4-(dimethylamino)butyl)- | ||
|---|---|---|---|---|
| CAS Number | 106626-58-8 | Molecular Weight | 321.41600 | |
| Density | 1.143g/cm3 | Boiling Point | 566.8ºC at 760 mmHg | |
| Molecular Formula | C20H23N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 296.6ºC | |
| Name | N-[4-(dimethylamino)butyl]acridine-4-carboxamide |
|---|
| Density | 1.143g/cm3 |
|---|---|
| Boiling Point | 566.8ºC at 760 mmHg |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.41600 |
| Flash Point | 296.6ºC |
| Exact Mass | 321.18400 |
| PSA | 48.72000 |
| LogP | 4.03440 |
| Vapour Pressure | 7.3E-13mmHg at 25°C |
| Index of Refraction | 1.634 |
| InChIKey | XNPDBHPDWFZJDS-UHFFFAOYSA-N |
| SMILES | CN(C)CCCCNC(=O)c1cccc2cc3ccccc3nc12 |
| HS Code | 2934999090 |
|---|
|
~%
4-Acridinecarbo... CAS#:106626-58-8 |
| Literature: Journal of Medicinal Chemistry, , vol. 30, # 4 p. 664 - 669 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |