3'-hydroxy-4'-methoxydiclofenac structure
|
Common Name | 3'-hydroxy-4'-methoxydiclofenac | ||
|---|---|---|---|---|
| CAS Number | 106610-60-0 | Molecular Weight | 342.17400 | |
| Density | 1.492g/cm3 | Boiling Point | 450.2ºC at 760mmHg | |
| Molecular Formula | C15H13Cl2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.1ºC | |
| Name | 3'-hydroxy-4'-methoxydiclofenac |
|---|---|
| Synonym | More Synonyms |
| Density | 1.492g/cm3 |
|---|---|
| Boiling Point | 450.2ºC at 760mmHg |
| Molecular Formula | C15H13Cl2NO4 |
| Molecular Weight | 342.17400 |
| Flash Point | 226.1ºC |
| Exact Mass | 341.02200 |
| PSA | 78.79000 |
| LogP | 4.15130 |
| Vapour Pressure | 6.83E-09mmHg at 25°C |
| Index of Refraction | 1.664 |
| InChIKey | YALZBLAHGKGDMB-UHFFFAOYSA-N |
| SMILES | COc1cc(Cl)c(Nc2ccccc2CC(=O)O)c(Cl)c1O |
| HS Code | 2922509090 |
|---|
|
~%
3'-hydroxy-4'-m... CAS#:106610-60-0 |
| Literature: Moser; Sallmann; Wiesenberg Journal of Medicinal Chemistry, 1990 , vol. 33, # 9 p. 2358 - 2368 |
|
~%
3'-hydroxy-4'-m... CAS#:106610-60-0 |
| Literature: Moser; Sallmann; Wiesenberg Journal of Medicinal Chemistry, 1990 , vol. 33, # 9 p. 2358 - 2368 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3'-Hydroxy-4'-methoxydiclofenac |
| 2-[2-(2,6-dichloro-3-hydroxy-4-methoxyanilino)phenyl]acetic acid |