tetrakis(dimethylamino)tin structure
|
Common Name | tetrakis(dimethylamino)tin | ||
|---|---|---|---|---|
| CAS Number | 1066-77-9 | Molecular Weight | 295.00400 | |
| Density | 1.17 | Boiling Point | 53-55ºC(0.1mmHg) | |
| Molecular Formula | C8H24N4Sn | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | -8ºC | |
| Symbol |
GHS02, GHS05, GHS07 |
Signal Word | Danger | |
| Name | N-methyl-N-[tris(dimethylamino)stannyl]methanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17 |
|---|---|
| Boiling Point | 53-55ºC(0.1mmHg) |
| Molecular Formula | C8H24N4Sn |
| Molecular Weight | 295.00400 |
| Flash Point | -8ºC |
| Exact Mass | 296.10200 |
| LogP | 2.09800 |
| Appearance of Characters | liquid | colorless to pale-yellow |
| Vapour Pressure | 1520mmHg at 25°C |
| InChIKey | WHXTVQNIFGXMSB-UHFFFAOYSA-N |
| SMILES | CN(C)[Sn](N(C)C)(N(C)C)N(C)C |
| Symbol |
GHS02, GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H302 + H312 + H332-H314 |
| Precautionary Statements | P210-P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US) |
| Hazard Codes | F: Flammable;C: Corrosive; |
| Risk Phrases | R20/21/22;R34 |
| Safety Phrases | S16-S26-S36/37/39-S45 |
| RIDADR | UN 2924 |
|
~58%
tetrakis(dimeth... CAS#:1066-77-9 |
| Literature: Jones, K.; Lappert, M. F. Journal of the Chemical Society, 1965 , p. 1944 - 1951 |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
| Octamethylstannanetetramine |
| Stannanetetramine,N,N,N',N',N'',N'',N''',N'''-octamethyl |
| MFCD00014860 |
| Stannanetetramine,octamethyl |