3,3-dimethyl-5-(6-oxo-1H-pyridazin-3-yl)-1H-indol-2-one
Modify Date: 2024-04-03 19:28:34
3,3-dimethyl-5-(6-oxo-1H-pyridazin-3-yl)-1H-indol-2-one structure
|
Common Name | 3,3-dimethyl-5-(6-oxo-1H-pyridazin-3-yl)-1H-indol-2-one | ||
|---|---|---|---|---|
| CAS Number | 106500-53-2 | Molecular Weight | 255.27200 | |
| Density | 1.38g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3-dimethyl-5-(6-oxo-1H-pyridazin-3-yl)-1H-indol-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.27200 |
| Exact Mass | 255.10100 |
| PSA | 78.60000 |
| LogP | 2.16400 |
| Index of Refraction | 1.687 |
| InChIKey | XYUOWTGQHOUXIO-UHFFFAOYSA-N |
| SMILES | CC1(C)C(=O)Nc2ccc(-c3ccc(=O)[nH]n3)cc21 |
|
~76%
3,3-dimethyl-5-... CAS#:106500-53-2 |
| Literature: Robertson, David W.; Jones, Noel D.; Krushinski, Joseph H.; Pollock, G. Don; Swartzendruber, John K.; Hayes, J. Scott Journal of Medicinal Chemistry, 1987 , vol. 30, # 4 p. 623 - 627 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Dehydroindolidan |