2-(5-methoxy-2-methyl-1-phenacyl-indol-3-yl)acetic acid
Modify Date: 2025-08-20 17:46:24
2-(5-methoxy-2-methyl-1-phenacyl-indol-3-yl)acetic acid structure
|
Common Name | 2-(5-methoxy-2-methyl-1-phenacyl-indol-3-yl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 106287-90-5 | Molecular Weight | 337.36900 | |
| Density | 1.22g/cm3 | Boiling Point | 578.2ºC at 760mmHg | |
| Molecular Formula | C20H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.5ºC | |
| Name | 2-(5-methoxy-2-methyl-1-phenacylindol-3-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 578.2ºC at 760mmHg |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.36900 |
| Flash Point | 303.5ºC |
| Exact Mass | 337.13100 |
| PSA | 68.53000 |
| LogP | 3.46830 |
| Vapour Pressure | 3.29E-14mmHg at 25°C |
| Index of Refraction | 1.6 |
| InChIKey | VHLOZYACBUHUAV-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)c(CC(=O)O)c(C)n2CC(=O)c1ccccc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-Phenacyl-2-methyl-5-methoxyindol-3-ylacetic acid |