Ethyl (4-Trifluoromethylbenzoyl)acetate structure
|
Common Name | Ethyl (4-Trifluoromethylbenzoyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 106263-53-0 | Molecular Weight | 260.209 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 294.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C12H11F3O3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 127.6±22.2 °C | |
| Name | Ethyl 3-oxo-3-(4-(trifluoromethyl)phenyl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 294.3±40.0 °C at 760 mmHg |
| Molecular Formula | C12H11F3O3 |
| Molecular Weight | 260.209 |
| Flash Point | 127.6±22.2 °C |
| Exact Mass | 260.066040 |
| PSA | 43.37000 |
| LogP | 2.84 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.461 |
| InChIKey | HVHVSJPSNQIPEM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1ccc(C(F)(F)F)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| Hazard Codes | F: Flammable; |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918300090 |
|
~72%
Ethyl (4-Triflu... CAS#:106263-53-0 |
| Literature: Chemistry - An Asian Journal, , vol. 6, # 8 p. 2073 - 2079 |
|
~%
Ethyl (4-Triflu... CAS#:106263-53-0 |
| Literature: EP1340749 A1, ; |
|
~59%
Ethyl (4-Triflu... CAS#:106263-53-0 |
| Literature: Journal of Medicinal Chemistry, , vol. 55, # 5 p. 1831 - 1843 |
|
~%
Ethyl (4-Triflu... CAS#:106263-53-0 |
| Literature: Chemistry - An Asian Journal, , vol. 6, # 8 p. 2073 - 2079 |
|
~%
Ethyl (4-Triflu... CAS#:106263-53-0 |
| Literature: Organometallics, , vol. 31, # 3 p. 966 - 975 |
|
~%
Ethyl (4-Triflu... CAS#:106263-53-0 |
| Literature: US2012/277224 A1, ; Page/Page column 28 ; US 20120277224 A1 |
|
~%
Ethyl (4-Triflu... CAS#:106263-53-0 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 7, # 6 p. 991 - 1002 |
|
~%
Ethyl (4-Triflu... CAS#:106263-53-0 |
| Literature: Tetrahedron Letters, , vol. 43, # 7 p. 1161 - 1164 |
|
~%
Ethyl (4-Triflu... CAS#:106263-53-0 |
| Literature: US2012/277224 A1, ; US 20120277224 A1 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Ethyl 3-oxo-3-[4-(trifluoromethyl)phenyl]propanoate |
| ethyl 3-(4-trifluoromethyl-phenyl)-3-oxopropanoate |
| Benzenepropanoic acid, β-oxo-4-(trifluoromethyl)-, ethyl ester |
| Ethyl (4-trifluoromethylbenzoyl)acetate |
| MFCD03424818 |