bis-tert-butyldimethylsilyl ether of (4R,5R)-4-hydroxy-5-hydroxymethyltetrahydrofuran-2-one structure
|
Common Name | bis-tert-butyldimethylsilyl ether of (4R,5R)-4-hydroxy-5-hydroxymethyltetrahydrofuran-2-one | ||
|---|---|---|---|---|
| CAS Number | 106183-56-6 | Molecular Weight | 360.63600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H36O4Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis-tert-butyldimethylsilyl ether of (4R,5R)-4-hydroxy-5-hydroxymethyltetrahydrofuran-2-one |
|---|
| Molecular Formula | C17H36O4Si2 |
|---|---|
| Molecular Weight | 360.63600 |
| Exact Mass | 360.21500 |
| PSA | 44.76000 |
| LogP | 4.71410 |
| InChIKey | DCFHRVSQGCDCMH-ZIAGYGMSSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1OC(=O)CC1O[Si](C)(C)C(C)(C)C |
|
~%
bis-tert-butyld... CAS#:106183-56-6 |
| Literature: Danilova, G. A.; Mel'nikova, V. I.; Pivnitsky, K. K. Tetrahedron Letters, 1986 , vol. 27, # 22 p. 2489 - 2490 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |