4,4'-(ethene-1,1-diyl)bis(bromobenzene) structure
|
Common Name | 4,4'-(ethene-1,1-diyl)bis(bromobenzene) | ||
|---|---|---|---|---|
| CAS Number | 10605-43-3 | Molecular Weight | 338.03700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10Br2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,4'-(ethene-1,1-diyl)bis(bromobenzene) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H10Br2 |
|---|---|
| Molecular Weight | 338.03700 |
| Exact Mass | 335.91500 |
| LogP | 5.27310 |
| InChIKey | BGSJPNSNYIXYBU-UHFFFAOYSA-N |
| SMILES | C=C(c1ccc(Br)cc1)c1ccc(Br)cc1 |
|
~%
4,4'-(ethene-1,... CAS#:10605-43-3 |
| Literature: Matsumoto, Takuya; Ishida, Takayuki; Koga, Noboru; Iwamura, Hiizu Journal of the American Chemical Society, 1992 , vol. 114, # 25 p. 9952 - 9959 |
|
~%
4,4'-(ethene-1,... CAS#:10605-43-3 |
| Literature: Cristol et al. Journal of the American Chemical Society, 1952 , vol. 74, p. 3333,3337 |
| 2,2-bis-(p-bromophenyl)ethylene |
| .1,1-bis(4-bromophenyl)ethylene |
| .1,1-bis-(4-bromo-phenyl)-ethene |
| .1,1-bis(p-bromophenyl)ethylene |
| .1,1-bis(4-bromophenyl)ethene |
| .4,4'-dibromophenylethylene |