1-[bis(4-methylphenyl)phosphoryl-(4-methylphenyl)phosphoryl]-4-methyl-benzene
Modify Date: 2025-08-26 11:14:34
![1-[bis(4-methylphenyl)phosphoryl-(4-methylphenyl)phosphoryl]-4-methyl-benzene Structure](https://image.chemsrc.com/caspic/487/1060-21-5.png)
1-[bis(4-methylphenyl)phosphoryl-(4-methylphenyl)phosphoryl]-4-methyl-benzene structure
|
Common Name | 1-[bis(4-methylphenyl)phosphoryl-(4-methylphenyl)phosphoryl]-4-methyl-benzene | ||
|---|---|---|---|---|
| CAS Number | 1060-21-5 | Molecular Weight | 458.46800 | |
| Density | 1.19g/cm3 | Boiling Point | 589.9ºC at 760mmHg | |
| Molecular Formula | C28H28O2P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[bis(4-methylphenyl)phosphoryl-(4-methylphenyl)phosphoryl]-4-methylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 589.9ºC at 760mmHg |
| Molecular Formula | C28H28O2P2 |
| Molecular Weight | 458.46800 |
| Exact Mass | 458.15600 |
| PSA | 53.76000 |
| LogP | 6.16320 |
| Vapour Pressure | 2.86E-13mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | CDSNRMGAIFNIHR-UHFFFAOYSA-N |
| SMILES | Cc1ccc(P(=O)(c2ccc(C)cc2)P(=O)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
|
~%
1-[bis(4-methyl... CAS#:1060-21-5 |
| Literature: Quin,L.D.; Anderson,H.G. Journal of Organic Chemistry, 1966 , vol. 31, p. 1206 - 1209 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Tetra-<p-tolyl>-diphosphin-dioxyd |
| Tetra-(p-tolyl)-diphosphinoxid |
| 1,1,2,2-tetrakis(4-methylphenyl)diphosphane 1,2-dioxide |