2-Pentyloxycarbanilic acid 1-methoxymethyl-2-(1-perhydroazepinyl)ethyl ester hydrochloride structure
|
Common Name | 2-Pentyloxycarbanilic acid 1-methoxymethyl-2-(1-perhydroazepinyl)ethyl ester hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 105919-73-1 | Molecular Weight | 392.53200 | |
| Density | 1.071g/cm3 | Boiling Point | 485.9ºC at 760mmHg | |
| Molecular Formula | C22H36N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.7ºC | |
Use of 2-Pentyloxycarbanilic acid 1-methoxymethyl-2-(1-perhydroazepinyl)ethyl ester hydrochlorideAntiarrhythmic agent-2 is a nonspecific Ca2+ inward current blocker that inhibits ionic currents in sensory neuron membranes. Antiarrhythmic agent-2 can be used in the study of cardiovascular diseases, such as arrhythmias[1]. |
| Name | [1-(azepan-1-yl)-3-methoxypropan-2-yl] N-(2-pentoxyphenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Description | Antiarrhythmic agent-2 is a nonspecific Ca2+ inward current blocker that inhibits ionic currents in sensory neuron membranes. Antiarrhythmic agent-2 can be used in the study of cardiovascular diseases, such as arrhythmias[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.071g/cm3 |
|---|---|
| Boiling Point | 485.9ºC at 760mmHg |
| Molecular Formula | C22H36N2O4 |
| Molecular Weight | 392.53200 |
| Flash Point | 247.7ºC |
| Exact Mass | 392.26800 |
| PSA | 63.52000 |
| LogP | 4.64660 |
| Vapour Pressure | 1.36E-09mmHg at 25°C |
| Index of Refraction | 1.525 |
| InChIKey | VVNITDZDOPJHAV-UHFFFAOYSA-N |
| SMILES | CCCCCOc1ccccc1NC(=O)OC(COC)CN1CCCCCC1 |
| bk 129 |