2-Formyl-4,5-dimethyl-pyrrole-3-carboxylic acid ethyl ester
Modify Date: 2025-08-26 21:43:40
2-Formyl-4,5-dimethyl-pyrrole-3-carboxylic acid ethyl ester structure
|
Common Name | 2-Formyl-4,5-dimethyl-pyrrole-3-carboxylic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 10591-23-8 | Molecular Weight | 195.21500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 2-formyl-4,5-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H13NO3 |
|---|---|
| Molecular Weight | 195.21500 |
| Exact Mass | 195.09000 |
| PSA | 59.16000 |
| LogP | 1.62070 |
| InChIKey | YLXBDAUTFPZBAH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C=O)[nH]c(C)c1C |
| HS Code | 2933990090 |
|---|
|
~%
2-Formyl-4,5-di... CAS#:10591-23-8 |
| Literature: Kleinspehn; Corwin Journal of the American Chemical Society, 1954 , vol. 76, p. 5641,5645 |
|
~%
2-Formyl-4,5-di... CAS#:10591-23-8 |
| Literature: Fischer; Beller Justus Liebigs Annalen der Chemie, 1925 , vol. 444, p. 245 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-ethoxycarbonyl-4,5-dimethyl-2-formylpyrrole |
| 2-Formyl-4,5-dimethyl-3-ethoxycarbonyl-pyrrol |
| 2-formyl-4,5-dimethyl-pyrrole-3-carboxylic acid ethyl ester |
| 2-formyl-4,4-dimethoxybutyronitrile |
| 2-Formyl-4,5-dimethyl-pyrrol-3-carbonsaeure-aethylester |
| 2,3-Dimethyl-4-ethoxycarbonyl-4-formyl-pyrrol |
| Butanenitrile,2-formyl-4,4-dimethoxy |
| 2-Formyl-4,5,6,7-tetrahydrobenzo<b>thiophen |
| 2-formyl,4,4-dimethoxybutanenitrile |
| 2-formyl-4,5,6,7-tetrahydrobenzothiene |