ACETIC ACID, ((4-NITROPHENYL)THIO)-, compd. with 2-AMINOETHANOL (1:1) structure
|
Common Name | ACETIC ACID, ((4-NITROPHENYL)THIO)-, compd. with 2-AMINOETHANOL (1:1) | ||
|---|---|---|---|---|
| CAS Number | 105892-18-0 | Molecular Weight | 274.29400 | |
| Density | N/A | Boiling Point | 417.2ºC at 760mmHg | |
| Molecular Formula | C10H14N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.1ºC | |
| Name | 2-hydroxyethylazanium,2-(4-nitrophenyl)sulfanylacetate |
|---|
| Boiling Point | 417.2ºC at 760mmHg |
|---|---|
| Molecular Formula | C10H14N2O5S |
| Molecular Weight | 274.29400 |
| Flash Point | 206.1ºC |
| Exact Mass | 274.06200 |
| PSA | 154.67000 |
| LogP | 1.93240 |
| Vapour Pressure | 1.05E-07mmHg at 25°C |
| InChIKey | PHGRMMVCLZDVJI-UHFFFAOYSA-N |
| SMILES | O=C([O-])CSc1ccc([N+](=O)[O-])cc1.[NH3+]CCO |
| HS Code | 2930909090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |