6-(4-methoxyphenyl)-3,5,6-trimethyl-1,3,4-oxadiazin-2-one
Modify Date: 2025-08-27 18:08:02
6-(4-methoxyphenyl)-3,5,6-trimethyl-1,3,4-oxadiazin-2-one structure
|
Common Name | 6-(4-methoxyphenyl)-3,5,6-trimethyl-1,3,4-oxadiazin-2-one | ||
|---|---|---|---|---|
| CAS Number | 105889-17-6 | Molecular Weight | 248.27800 | |
| Density | 1.16g/cm3 | Boiling Point | 336ºC at 760mmHg | |
| Molecular Formula | C13H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157ºC | |
| Name | 6-(4-methoxyphenyl)-3,5,6-trimethyl-1,3,4-oxadiazin-2-one |
|---|
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 336ºC at 760mmHg |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.27800 |
| Flash Point | 157ºC |
| Exact Mass | 248.11600 |
| PSA | 51.13000 |
| LogP | 1.74180 |
| Vapour Pressure | 0.000115mmHg at 25°C |
| Index of Refraction | 1.55 |
| InChIKey | YQHDSOFELPIUBM-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2(C)OC(=O)N(C)N=C2C)cc1 |
|
~%
6-(4-methoxyphe... CAS#:105889-17-6 |
| Literature: Gohee; Boucherle; Robin European Journal of Medicinal Chemistry, 1986 , vol. 21, # 5 p. 403 - 409 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |