[2-(4-ethoxyphenyl)imino-2-(4-methoxyanilino)ethyl] N,N-diethylcarbamodithioate structure
|
Common Name | [2-(4-ethoxyphenyl)imino-2-(4-methoxyanilino)ethyl] N,N-diethylcarbamodithioate | ||
|---|---|---|---|---|
| CAS Number | 105858-94-4 | Molecular Weight | 431.61500 | |
| Density | 1.12g/cm3 | Boiling Point | 577.1ºC at 760mmHg | |
| Molecular Formula | C22H29N3O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 302.8ºC | |
| Name | [2-(4-ethoxyphenyl)imino-2-(4-methoxyanilino)ethyl] N,N-diethylcarbamodithioate |
|---|
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 577.1ºC at 760mmHg |
| Molecular Formula | C22H29N3O2S2 |
| Molecular Weight | 431.61500 |
| Flash Point | 302.8ºC |
| Exact Mass | 431.17000 |
| PSA | 103.48000 |
| LogP | 5.66890 |
| Vapour Pressure | 2.55E-13mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | IEIRTQHMYQQWSP-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(N=C(CSC(=S)N(CC)CC)Nc2ccc(OC)cc2)cc1 |
|
~43%
[2-(4-ethoxyphe... CAS#:105858-94-4 |
| Literature: Pantev, Totyu P Journal of Medicinal Chemistry, 1987 , vol. 30, # 4 p. 720 - 721 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |