[2-(4-methylanilino)-2-(4-methylphenyl)iminoethyl] N,N-diethylcarbamodithioate
Modify Date: 2025-09-22 23:34:50
![[2-(4-methylanilino)-2-(4-methylphenyl)iminoethyl] N,N-diethylcarbamodithioate Structure](https://image.chemsrc.com/caspic/298/105858-90-0.png)
[2-(4-methylanilino)-2-(4-methylphenyl)iminoethyl] N,N-diethylcarbamodithioate structure
|
Common Name | [2-(4-methylanilino)-2-(4-methylphenyl)iminoethyl] N,N-diethylcarbamodithioate | ||
|---|---|---|---|---|
| CAS Number | 105858-90-0 | Molecular Weight | 385.58900 | |
| Density | 1.09g/cm3 | Boiling Point | 531.4ºC at 760 mmHg | |
| Molecular Formula | C21H27N3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.2ºC | |
| Name | [2-(4-methylanilino)-2-(4-methylphenyl)iminoethyl] N,N-diethylcarbamodithioate |
|---|
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 531.4ºC at 760 mmHg |
| Molecular Formula | C21H27N3S2 |
| Molecular Weight | 385.58900 |
| Flash Point | 275.2ºC |
| Exact Mass | 385.16500 |
| PSA | 85.02000 |
| LogP | 5.87840 |
| Vapour Pressure | 2.24E-11mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | FWLCYOBOLHJMCL-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=S)SCC(=Nc1ccc(C)cc1)Nc1ccc(C)cc1 |
|
~65%
[2-(4-methylani... CAS#:105858-90-0 |
| Literature: Pantev, Totyu P Journal of Medicinal Chemistry, 1987 , vol. 30, # 4 p. 720 - 721 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |