(4-chlorophenyl)-diethoxyphosphorylmethanone structure
|
Common Name | (4-chlorophenyl)-diethoxyphosphorylmethanone | ||
|---|---|---|---|---|
| CAS Number | 10570-46-4 | Molecular Weight | 276.65300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14ClO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-chlorophenyl)-diethoxyphosphorylmethanone |
|---|
| Molecular Formula | C11H14ClO4P |
|---|---|
| Molecular Weight | 276.65300 |
| Exact Mass | 276.03200 |
| PSA | 62.41000 |
| LogP | 3.74630 |
| InChIKey | VDKATAVRWLSKCS-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)C(=O)c1ccc(Cl)cc1 |
|
~96%
(4-chlorophenyl... CAS#:10570-46-4 |
| Literature: Firouzabadi, Habib; Iranpoor, Nasser; Sobhani, Sara Synthetic Communications, 2004 , vol. 34, # 8 p. 1463 - 1471 |
|
~74%
(4-chlorophenyl... CAS#:10570-46-4 |
| Literature: Sprecher, Milon; Kost, Daniel Journal of the American Chemical Society, 1994 , vol. 116, # 3 p. 1016 - 1026 |
|
~%
(4-chlorophenyl... CAS#:10570-46-4 |
| Literature: Kaboudin; Nazari Synthetic Communications, 2001 , vol. 31, # 15 p. 2245 - 2250 |