3,5-Pyrazolidinedione,4-[2-(methylthio)ethyl]-1,2-diphenyl- structure
|
Common Name | 3,5-Pyrazolidinedione,4-[2-(methylthio)ethyl]-1,2-diphenyl- | ||
|---|---|---|---|---|
| CAS Number | 10561-02-1 | Molecular Weight | 326.41300 | |
| Density | 1.254g/cm3 | Boiling Point | 460.9ºC at 760mmHg | |
| Molecular Formula | C18H18N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.5ºC | |
| Name | 4-(2-methylsulfanylethyl)-1,2-diphenylpyrazolidine-3,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.254g/cm3 |
|---|---|
| Boiling Point | 460.9ºC at 760mmHg |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.41300 |
| Flash Point | 232.5ºC |
| Exact Mass | 326.10900 |
| PSA | 65.92000 |
| LogP | 3.48070 |
| Vapour Pressure | 1.12E-08mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | KRIKNPNYONBUKG-UHFFFAOYSA-N |
| SMILES | CSCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O |
| HS Code | 2933990090 |
|---|
|
~%
3,5-Pyrazolidin... CAS#:10561-02-1 |
| Literature: Geigy A.G. Patent: US2700671 , 1952 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyrazolin-3,5-dione,1,2-diphenyl-4-methylthioethyl |