Nimbocinone structure
|
Common Name | Nimbocinone | ||
|---|---|---|---|---|
| CAS Number | 105532-11-4 | Molecular Weight | 470.68 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H46O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of NimbocinoneNimbocinone shows antidiabetogenic activity. |
| Name | Nimbocinone |
|---|
| Description | Nimbocinone shows antidiabetogenic activity. |
|---|---|
| References | 1. Gurulingappa H, Tare V, Pawar P, Tungikar V, Jorapur YR, Madhavi S, Bhat SV. Susceptibility of Aedes aegypti and Culex quinquefasciatus Larvae to gedunin-related limonoids. Chem Biodivers. 2009 Jun;6(6):897-902. doi: 10.1002/cbdv.200800105. PubMed PMID: 19551731. |
| Molecular Formula | C30H46O4 |
|---|---|
| Molecular Weight | 470.68 |
| InChIKey | AIPJHGJDKFLPMI-GAWIFWETSA-N |
| SMILES | CC(CO)C(O)C1CC(C2CCC3(C)C4=CCC5C(C)(C)C(=O)CCC5(C)C4CCC23C)=CO1 |