N-acetyloxytocin structure
|
Common Name | N-acetyloxytocin | ||
|---|---|---|---|---|
| CAS Number | 10551-48-1 | Molecular Weight | 1049.224 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 1593.2±65.0 °C at 760 mmHg | |
| Molecular Formula | C45H68N12O13S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 917.3±34.3 °C | |
Use of N-acetyloxytocinN-Acetyloxytocin is isolated and characterized in the neurointermediate lobe of the rat pituitary (NIL) and their presence in several brain areas of the rat[1]. |
| Name | 1-{[(4R,7S,10S,13S,16S,19R)-19-Acetamido-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-13-[(2S)-2-butanyl]-16-(4-hydroxybenzyl)-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloicosan-4-yl]carbonyl}-L-prolyl-L-leucylglycinamide |
|---|---|
| Synonym | More Synonyms |
| Description | N-Acetyloxytocin is isolated and characterized in the neurointermediate lobe of the rat pituitary (NIL) and their presence in several brain areas of the rat[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Nα-acetylation is a post-translational modification of vasopressin (VP), and oxytocin (OT). The acetylated forms arc not restricted to the pineal gland, the tissue in which Nα-acetyl-OT is initially identified, but also occur in other systems producing OT and VP[1]. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 1593.2±65.0 °C at 760 mmHg |
| Molecular Formula | C45H68N12O13S2 |
| Molecular Weight | 1049.224 |
| Flash Point | 917.3±34.3 °C |
| Exact Mass | 1048.447021 |
| LogP | -3.89 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | RROMYFJBCBPTNU-FTLGEDQVSA-N |
| SMILES | CCC(C)C1NC(=O)C(Cc2ccc(O)cc2)NC(=O)C(NC(C)=O)CSSCC(C(=O)N2CCCC2C(=O)NC(CC(C)C)C(=O)NCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(CCC(N)=O)NC1=O |
| 1-{[(4R,7S,10S,13S,16S,19R)-19-Acetamido-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-13-[(2S)-2-butanyl]-16-(4-hydroxybenzyl)-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloicosan-4-yl]carbonyl}-L-prolyl-L-leucylglycinamide |
| Glycinamide, 1-[[(4R,7S,10S,13S,16S,19R)-19-(acetylamino)-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-16-[(4-hydroxyphenyl)methyl]-13-[(1S)-1-methylpropyl]-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloeicos-4-yl]carbonyl]-L-prolyl-L-leucyl- |