2H-1-Benzopyran-2-one,7-hydroxy-4-methyl-8-(1-piperidinylmethyl)- structure
|
Common Name | 2H-1-Benzopyran-2-one,7-hydroxy-4-methyl-8-(1-piperidinylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 10549-62-9 | Molecular Weight | 273.32700 | |
| Density | 1.242g/cm3 | Boiling Point | 460.3ºC at 760mmHg | |
| Molecular Formula | C16H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.2ºC | |
| Name | 7-hydroxy-4-methyl-8-(piperidin-1-ylmethyl)chromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.242g/cm3 |
|---|---|
| Boiling Point | 460.3ºC at 760mmHg |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.32700 |
| Flash Point | 232.2ºC |
| Exact Mass | 273.13600 |
| PSA | 53.68000 |
| LogP | 2.73080 |
| Vapour Pressure | 4.29E-09mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | DIJMIZCQAHRDQL-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)oc2c(CN3CCCCC3)c(O)ccc12 |
|
~67%
2H-1-Benzopyran... CAS#:10549-62-9 |
| Literature: Ghantwal; Samant Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 1999 , vol. 38, # 11 p. 1242 - 1247 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 7-hydroxy-4-methyl-8-(piperidinomethyl)coumarin |
| 7-Hydroxy-4-methyl-8-piperidinomethyl-cumarin |
| 8-Piperidinomethyl-7-hydroxy-4-methyl-cumarin |
| HMS1479O11 |
| 7-hydroxy-4-methyl-8-piperidin-1-ylmethyl-chromen-2-one |