1,4-dichloro-2-(trichloromethyl)benzene
Modify Date: 2025-09-26 19:12:04
1,4-dichloro-2-(trichloromethyl)benzene structure
|
Common Name | 1,4-dichloro-2-(trichloromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 10541-71-6 | Molecular Weight | 264.36400 | |
| Density | 1.605g/cm3 | Boiling Point | 283.3ºC at 760mmHg | |
| Molecular Formula | C7H3Cl5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.5ºC | |
| Name | 1,4-dichloro-2-(trichloromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.605g/cm3 |
|---|---|
| Boiling Point | 283.3ºC at 760mmHg |
| Molecular Formula | C7H3Cl5 |
| Molecular Weight | 264.36400 |
| Flash Point | 126.5ºC |
| Exact Mass | 261.86800 |
| LogP | 4.82010 |
| Vapour Pressure | 0.00547mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | GSRCWOBJTVTICJ-UHFFFAOYSA-N |
| SMILES | Clc1ccc(Cl)c(C(Cl)(Cl)Cl)c1 |
| HS Code | 2903999090 |
|---|
|
~%
1,4-dichloro-2-... CAS#:10541-71-6 |
| Literature: Bayer Aktiengesellschaft Patent: US5273627 A1, 1993 ; |
|
~%
1,4-dichloro-2-... CAS#:10541-71-6 |
| Literature: Sutherland, Ronald G.; Zhang, Chunhao; Piorko, Adam Journal of Organometallic Chemistry, 1991 , vol. 419, # 3 p. 357 - 373 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:50-79-3| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Einecs 234-120-1 |
| 1,4-Dichlor-2-trichlormethyl-benzol |
| 2,5-dichlorobenzotrichloride |
| 1-(Trichloromethyl)-2,5-dichlorobenzene |
| 2,5-Dichlorbenzotrichlorid |
| 1,4-dichloro-2-trichloromethyl-benzene |