Methane,bis(2,5-dichlorophenyl)- (7CI,8CI) structure
|
Common Name | Methane,bis(2,5-dichlorophenyl)- (7CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 10541-64-7 | Molecular Weight | 306.01500 | |
| Density | 1.412g/cm3 | Boiling Point | 370.7ºC at 760 mmHg | |
| Molecular Formula | C13H8Cl4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.1ºC | |
| Name | 1,4-dichloro-2-[(2,5-dichlorophenyl)methyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.412g/cm3 |
|---|---|
| Boiling Point | 370.7ºC at 760 mmHg |
| Molecular Formula | C13H8Cl4 |
| Molecular Weight | 306.01500 |
| Flash Point | 177.1ºC |
| Exact Mass | 303.93800 |
| LogP | 5.89100 |
| Vapour Pressure | 2.31E-05mmHg at 25°C |
| Index of Refraction | 1.61 |
| InChIKey | JHQUTSDSPDPQCL-UHFFFAOYSA-N |
| SMILES | Clc1ccc(Cl)c(Cc2cc(Cl)ccc2Cl)c1 |
|
~%
Methane,bis(2,5... CAS#:10541-64-7 |
| Literature: Welch; Smith Journal of the American Chemical Society, 1951 , vol. 73, p. 4391 |
|
~%
Methane,bis(2,5... CAS#:10541-64-7 |
| Literature: Olivier,M.; Marechal,E. Bulletin de la Societe Chimique de France, 1974 , p. 699 - 700 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,1'-methanediylbis(2,5-dichlorobenzene) |
| Bis-(2,5-dichlor-phenyl)-methan |
| bis-(2,5-dichloro-phenyl)-methane |
| 2,2',5,5'-Tetrachlordiphenylmethan |