1-[6-[bis(2-hydroxy-3-phenoxy-propyl)amino]hexyl-(2-hydroxy-3-phenoxy- propyl)amino]-3-phenoxy-propan-2-ol structure
|
Common Name | 1-[6-[bis(2-hydroxy-3-phenoxy-propyl)amino]hexyl-(2-hydroxy-3-phenoxy- propyl)amino]-3-phenoxy-propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 105386-85-4 | Molecular Weight | 716.90300 | |
| Density | 1.184g/cm3 | Boiling Point | 848.3ºC at 760mmHg | |
| Molecular Formula | C42H56N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 466.8ºC | |
| Name | 1-[6-[bis(2-hydroxy-3-phenoxypropyl)amino]hexyl-(2-hydroxy-3-phenoxypropyl)amino]-3-phenoxypropan-2-ol |
|---|
| Density | 1.184g/cm3 |
|---|---|
| Boiling Point | 848.3ºC at 760mmHg |
| Molecular Formula | C42H56N2O8 |
| Molecular Weight | 716.90300 |
| Flash Point | 466.8ºC |
| Exact Mass | 716.40400 |
| PSA | 124.32000 |
| LogP | 4.91040 |
| Vapour Pressure | 1.35E-30mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | OHERUBJDVQSNSA-UHFFFAOYSA-N |
| SMILES | OC(COc1ccccc1)CN(CCCCCCN(CC(O)COc1ccccc1)CC(O)COc1ccccc1)CC(O)COc1ccccc1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |