2-cyclohex-2-en-1-yl-1,1-dioxo-1,2-benzothiazol-3-one structure
|
Common Name | 2-cyclohex-2-en-1-yl-1,1-dioxo-1,2-benzothiazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 105338-19-0 | Molecular Weight | 263.31200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-cyclohex-2-en-1-yl-1,1-dioxo-1,2-benzothiazol-3-one |
|---|
| Molecular Formula | C13H13NO3S |
|---|---|
| Molecular Weight | 263.31200 |
| Exact Mass | 263.06200 |
| PSA | 62.83000 |
| LogP | 2.95850 |
| InChIKey | YWKMVDVYWRSMJD-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2S(=O)(=O)N1C1C=CCCC1 |
|
~26%
2-cyclohex-2-en... CAS#:105338-19-0 |
| Literature: Giner, Xavier; Najera, Carmen; Kovacs, Gabor; Lledos, Agusti; Ujaque, Gregori Advanced Synthesis and Catalysis, 2011 , vol. 353, # 18 p. 3451 - 3466 |
|
~%
2-cyclohex-2-en... CAS#:105338-19-0 |
| Literature: Fono Chemistry and Industry (London, United Kingdom), 1958 , p. 414 |
|
~%
Detail
|
| Literature: Fono Chemistry and Industry (London, United Kingdom), 1958 , p. 414 |