5-(Aminomethyl)-2-adamantanol hydrochloridehydrate structure
|
Common Name | 5-(Aminomethyl)-2-adamantanol hydrochloridehydrate | ||
|---|---|---|---|---|
| CAS Number | 1053170-70-9 | Molecular Weight | 217.73600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H20ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(aminomethyl)adamantan-2-ol,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H20ClNO |
|---|---|
| Molecular Weight | 217.73600 |
| Exact Mass | 217.12300 |
| PSA | 46.25000 |
| LogP | 2.63460 |
| InChIKey | KLDHFVZEQIBFAV-UHFFFAOYSA-N |
| SMILES | Cl.NCC12CC3CC(C1)C(O)C(C3)C2 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-(aminomethyl)adamantan-2-ol hydrochloride |