CTP structure
|
Common Name | CTP | ||
|---|---|---|---|---|
| CAS Number | 1052692-86-0 | Molecular Weight | 1432.54 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C64H93N19O19 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CTPCTP is a cardiac targeting peptide. CTP transduces cardiomyocytes in vitro. CTP leads to efficient and specific transduction of heart tissue in mice model. CTP can be used to deliver therapeutic peptides, proteins and nucleic acid specifically to the heart[1]. |
| Name | CTP |
|---|
| Description | CTP is a cardiac targeting peptide. CTP transduces cardiomyocytes in vitro. CTP leads to efficient and specific transduction of heart tissue in mice model. CTP can be used to deliver therapeutic peptides, proteins and nucleic acid specifically to the heart[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C64H93N19O19 |
|---|---|
| Molecular Weight | 1432.54 |
| InChIKey | MAHZUEBLXAXNKY-PLNOUXKFSA-N |
| SMILES | CC(C)CC(NC(=O)C(Cc1cnc[nH]1)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C1CCCN1C(=O)C(C)N)C(=O)NC(CO)C(=O)NC(CO)C(=O)NC(CCC(N)=O)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CO)C(=O)NC(CCCN=C(N)N)C(=O)NC(C(=O)O)C(C)O |