5-methoxy-2-phenylsulfanylnaphthalene-1,4-dione structure
|
Common Name | 5-methoxy-2-phenylsulfanylnaphthalene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 105259-49-2 | Molecular Weight | 296.34000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H12O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-methoxy-2-phenylsulfanylnaphthalene-1,4-dione |
|---|
| Molecular Formula | C17H12O3S |
|---|---|
| Molecular Weight | 296.34000 |
| Exact Mass | 296.05100 |
| PSA | 68.67000 |
| LogP | 3.75040 |
| InChIKey | NRNLBHUQOUYMFY-UHFFFAOYSA-N |
| SMILES | COc1cccc2c1C(=O)C=C(Sc1ccccc1)C2=O |
|
~88%
5-methoxy-2-phe... CAS#:105259-49-2 |
| Literature: Laugraud; Guingant; Chassagnard; d'Angelo Journal of Organic Chemistry, 1988 , vol. 53, # 7 p. 1557-1560 |
|
~%
5-methoxy-2-phe... CAS#:105259-49-2 |
| Literature: Laugraud; Guingant; Chassagnard; d'Angelo Journal of Organic Chemistry, 1988 , vol. 53, # 7 p. 1557-1560 |
|
~%
5-methoxy-2-phe... CAS#:105259-49-2 |
| Literature: Iwao, Masatomo; Kuraishi, Tsukasa Tetrahedron Letters, 1985 , vol. 26, # 50 p. 6213 - 6216 |