1-ethenylpyrrolidin-2-one,5-ethenyl-2H-tetrazole
Modify Date: 2025-12-01 18:34:19
1-ethenylpyrrolidin-2-one,5-ethenyl-2H-tetrazole structure
|
Common Name | 1-ethenylpyrrolidin-2-one,5-ethenyl-2H-tetrazole | ||
|---|---|---|---|---|
| CAS Number | 105241-63-2 | Molecular Weight | 207.23200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H13N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-ethenylpyrrolidin-2-one,5-ethenyl-2H-tetrazole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H13N5O |
|---|---|
| Molecular Weight | 207.23200 |
| Exact Mass | 207.11200 |
| PSA | 74.77000 |
| LogP | 0.53290 |
| Vapour Pressure | 0.132mmHg at 25°C |
| InChIKey | KRPKVERRHCPGLE-UHFFFAOYSA-N |
| SMILES | C=CN1CCCC1=O.C=Cc1nn[nH]n1 |
| 1H-Tetrazole,5-ethenyl-,polymer with 1-ethenyl-2-pyrrolidinone |
| 2-Pyrrolidinone,1-ethenyl-,polymer with 5-ethenyl-1H-tetrazole |
| 5-ethenyl-2H-tetrazole |