(Z)-but-2-enedioic acid,(2S)-1-[(2S)-2-[[(2R)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylic acid,5-O-ethyl 3-O-methyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate structure
|
Common Name | (Z)-but-2-enedioic acid,(2S)-1-[(2S)-2-[[(2R)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylic acid,5-O-ethyl 3-O-methyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 1051956-30-9 | Molecular Weight | 876.77300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C42H51Cl2N3O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (Z)-but-2-enedioic acid,(2S)-1-[(2S)-2-[[(2R)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylic acid,5-O-ethyl 3-O-methyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C42H51Cl2N3O13 |
|---|---|
| Molecular Weight | 876.77300 |
| Exact Mass | 875.28000 |
| PSA | 235.17000 |
| LogP | 5.93830 |
| InChIKey | DPNLWHDRPGNSKB-IKNOHHBKSA-N |
| SMILES | CCOC(=O)C(CCc1ccccc1)NC(C)C(=O)N1CCCC1C(=O)O.CCOC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1cccc(Cl)c1Cl.O=C(O)C=CC(=O)O |
| Enalapril maleate mixture with felodipine |
| Enalapril maleate and felodipine |