[4,10-bis(trimethylsilyl)-1-oxa-4,7,10-triazacyclododec-7-yl]-trimethylsilane
Modify Date: 2025-09-18 10:13:57
![[4,10-bis(trimethylsilyl)-1-oxa-4,7,10-triazacyclododec-7-yl]-trimethylsilane Structure](https://image.chemsrc.com/caspic/474/105121-48-0.png)
[4,10-bis(trimethylsilyl)-1-oxa-4,7,10-triazacyclododec-7-yl]-trimethylsilane structure
|
Common Name | [4,10-bis(trimethylsilyl)-1-oxa-4,7,10-triazacyclododec-7-yl]-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 105121-48-0 | Molecular Weight | 389.79900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H43N3OSi3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [4,10-bis(trimethylsilyl)-1-oxa-4,7,10-triazacyclododec-7-yl]-trimethylsilane |
|---|
| Molecular Formula | C17H43N3OSi3 |
|---|---|
| Molecular Weight | 389.79900 |
| Exact Mass | 389.27100 |
| PSA | 18.95000 |
| LogP | 3.24100 |
| InChIKey | KMAJOPYVSZAUSK-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)N1CCOCCN([Si](C)(C)C)CCN([Si](C)(C)C)CC1 |
|
~%
[4,10-bis(trime... CAS#:105121-48-0 |
| Literature: Farnham, William B.; Dixon, David A.; Middleton, William J.; Calabrese, Jodeph C.; Harlow, Richard L.; et al. Journal of the American Chemical Society, 1987 , vol. 109, # 2 p. 476 - 483 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |