1-(2-amino-4-nitrophenyl)ethanone,hydrochloride structure
|
Common Name | 1-(2-amino-4-nitrophenyl)ethanone,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1049728-54-2 | Molecular Weight | 216.62200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H9ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-amino-4-nitrophenyl)ethanone,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H9ClN2O3 |
|---|---|
| Molecular Weight | 216.62200 |
| Exact Mass | 216.03000 |
| PSA | 88.91000 |
| LogP | 3.28600 |
| InChIKey | IYMVSNFKXCSUBE-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc([N+](=O)[O-])cc1N.Cl |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-ACETYL-5-NITROANILINE HCL |
| 2-acetyl-5-nitroaniline hydrochloride |