6-[(5,7-disulfonaphthalen-2-yl)carbamoylamino]naphthalene-1,3-disulfonic acid
Modify Date: 2025-09-28 15:51:31
![6-[(5,7-disulfonaphthalen-2-yl)carbamoylamino]naphthalene-1,3-disulfonic acid Structure](https://image.chemsrc.com/caspic/172/104954-42-9.png)
6-[(5,7-disulfonaphthalen-2-yl)carbamoylamino]naphthalene-1,3-disulfonic acid structure
|
Common Name | 6-[(5,7-disulfonaphthalen-2-yl)carbamoylamino]naphthalene-1,3-disulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 104954-42-9 | Molecular Weight | 632.61700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H16N2O13S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-[(5,7-disulfonaphthalen-2-yl)carbamoylamino]naphthalene-1,3-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H16N2O13S4 |
|---|---|
| Molecular Weight | 632.61700 |
| Exact Mass | 631.95400 |
| PSA | 292.13000 |
| LogP | 7.09300 |
| InChIKey | BADLLIMIENDXQI-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc2c(S(=O)(=O)O)cc(S(=O)(=O)O)cc2c1)Nc1ccc2c(S(=O)(=O)O)cc(S(=O)(=O)O)cc2c1 |
|
~%
6-[(5,7-disulfo... CAS#:104954-42-9 |
| Literature: Balaban; King Journal of the Chemical Society, 1927 , p. 3091 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6,6'-ureylene-bis-naphthalene-1,3-disulfonic acid |
| 6,6'-Ureylen-bis-naphthalin-1,3-disulfonsaeure |