tert-butyl-(3,3-dimethylbut-1-ynoxy)-dimethylsilane
Modify Date: 2025-09-16 11:14:23
tert-butyl-(3,3-dimethylbut-1-ynoxy)-dimethylsilane structure
|
Common Name | tert-butyl-(3,3-dimethylbut-1-ynoxy)-dimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 104808-03-9 | Molecular Weight | 212.40400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H24OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl-(3,3-dimethylbut-1-ynoxy)-dimethylsilane |
|---|
| Molecular Formula | C12H24OSi |
|---|---|
| Molecular Weight | 212.40400 |
| Exact Mass | 212.16000 |
| PSA | 9.23000 |
| LogP | 4.01520 |
| InChIKey | DXGTYQYUVPUKKA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C#CO[Si](C)(C)C(C)(C)C |
|
~55%
tert-butyl-(3,3... CAS#:104808-03-9 |
| Literature: Stang,P.J.; Roberts,K.A. Journal of the American Chemical Society, 1986 , vol. 108, p. 7125 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |