2-(4-fluoro-5,6,7,8-tetrahydronaphthalene-1-carbonyl)benzoic acid structure
|
Common Name | 2-(4-fluoro-5,6,7,8-tetrahydronaphthalene-1-carbonyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 104761-50-4 | Molecular Weight | 298.30800 | |
| Density | 1.29g/cm3 | Boiling Point | 536.5ºC at 760 mmHg | |
| Molecular Formula | C18H15FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.2ºC | |
| Name | 2-(4-fluoro-5,6,7,8-tetrahydronaphthalene-1-carbonyl)benzoic acid |
|---|
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 536.5ºC at 760 mmHg |
| Molecular Formula | C18H15FO3 |
| Molecular Weight | 298.30800 |
| Flash Point | 278.2ºC |
| Exact Mass | 298.10100 |
| PSA | 54.37000 |
| LogP | 3.63370 |
| Vapour Pressure | 2.44E-12mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | AXYNVIFBEYDQAB-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1C(=O)c1ccc(F)c2c1CCCC2 |
|
~%
2-(4-fluoro-5,6... CAS#:104761-50-4 |
| Literature: Witiak, Donald T.; Abood, Norman A.; Goswami, Shyamaprosad; Milo, George E. Journal of Organic Chemistry, 1986 , vol. 51, # 24 p. 4499 - 4507 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |