Naphthoxylactic acid
Modify Date: 2025-08-26 14:05:14
Naphthoxylactic acid structure
|
Common Name | Naphthoxylactic acid | ||
|---|---|---|---|---|
| CAS Number | 10476-54-7 | Molecular Weight | 232.23200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Naphthoxylactic acid |
|---|
| Molecular Formula | C13H12O4 |
|---|---|
| Molecular Weight | 232.23200 |
| Exact Mass | 232.07400 |
| PSA | 66.76000 |
| LogP | 1.66410 |
| Vapour Pressure | 2.22E-08mmHg at 25°C |
| InChIKey | CFQFHRDQYGTGFA-UHFFFAOYSA-N |
| SMILES | O=C(O)C(O)COc1cccc2ccccc12 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |