3-[[4-[(3-carboxyphenyl)iminomethyl]phenyl]methylideneamino]benzoic acid
Modify Date: 2025-08-23 17:19:23
![3-[[4-[(3-carboxyphenyl)iminomethyl]phenyl]methylideneamino]benzoic acid Structure](https://image.chemsrc.com/caspic/345/104752-19-4.png)
3-[[4-[(3-carboxyphenyl)iminomethyl]phenyl]methylideneamino]benzoic acid structure
|
Common Name | 3-[[4-[(3-carboxyphenyl)iminomethyl]phenyl]methylideneamino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 104752-19-4 | Molecular Weight | 372.37300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[[4-[(3-carboxyphenyl)iminomethyl]phenyl]methylideneamino]benzoic acid |
|---|
| Molecular Formula | C22H16N2O4 |
|---|---|
| Molecular Weight | 372.37300 |
| Exact Mass | 372.11100 |
| PSA | 99.32000 |
| LogP | 4.58420 |
| InChIKey | JAZTUPYMICDXGO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(N=Cc2ccc(C=Nc3cccc(C(=O)O)c3)cc2)c1 |
| HS Code | 2925290090 |
|---|
|
~95%
3-[[4-[(3-carbo... CAS#:104752-19-4 |
| Literature: Lewkowski, Jaroslaw Phosphorus, Sulfur and Silicon and the Related Elements, 2005 , vol. 180, # 1 p. 179 - 195 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |