1,3-dibutyl-2-ethyl-4,5-dimethyl-1,3-diaza-2$l^{5}-phosphacyclopent-4- ene 2-oxide structure
|
Common Name | 1,3-dibutyl-2-ethyl-4,5-dimethyl-1,3-diaza-2$l^{5}-phosphacyclopent-4- ene 2-oxide | ||
|---|---|---|---|---|
| CAS Number | 104728-29-2 | Molecular Weight | 272.36700 | |
| Density | 0.99g/cm3 | Boiling Point | 347.8ºC at 760mmHg | |
| Molecular Formula | C14H29N2OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.2ºC | |
| Name | 1,3-dibutyl-2-ethyl-4,5-dimethyl-1,3,2λ5-diazaphosphole 2-oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.99g/cm3 |
|---|---|
| Boiling Point | 347.8ºC at 760mmHg |
| Molecular Formula | C14H29N2OP |
| Molecular Weight | 272.36700 |
| Flash Point | 164.2ºC |
| Exact Mass | 272.20200 |
| PSA | 33.36000 |
| LogP | 4.54440 |
| Vapour Pressure | 5.24E-05mmHg at 25°C |
| Index of Refraction | 1.489 |
| InChIKey | XFRDMMKKZHCHBF-UHFFFAOYSA-N |
| SMILES | CCCCN1C(C)=C(C)N(CCCC)P1(=O)CC |
| HS Code | 2934999090 |
|---|
|
~73%
1,3-dibutyl-2-e... CAS#:104728-29-2 |
| Literature: Kibardin; Gryaznova; Gryaznov; Pudovik Russian Journal of General Chemistry, 1996 , vol. 66, # 9 p. 1415 - 1417 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3,2-Diazaphosphol-4-ene,2-ethyl-2-oxo-1,3-dibutyl-4,5-dimethyl |
| 1H-1,3,2-Diazaphosphole,1,3-dibutyl-2-ethyl-2,3-dihydro-4,5-dimethyl-,2-oxide |
| 1,3-dibutyl-2-ethyl-4,5-dimethyl-1,3,2 |
| 2-oxo-2-ethyl-1,3-dibutyl-4,5-dimethyl-1,3,2-diazaphospholene |
| 1,3-dibutyl-2-ethyl-4,5-dimethyl-2,3-dihydro-1H-1,3,2-diazaphosphole 2-oxide |