2,4-diphenylbenzoic acid structure
|
Common Name | 2,4-diphenylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 10468-76-5 | Molecular Weight | 274.31300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-diphenylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H14O2 |
|---|---|
| Molecular Weight | 274.31300 |
| Exact Mass | 274.09900 |
| PSA | 37.30000 |
| LogP | 4.71880 |
| InChIKey | WSWCFLBLBDQRNK-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(-c2ccccc2)cc1-c1ccccc1 |
|
~%
2,4-diphenylben... CAS#:10468-76-5 |
| Literature: Bradsher; Swerlick Journal of the American Chemical Society, 1950 , vol. 72, p. 4189,4190 |
|
~%
2,4-diphenylben... CAS#:10468-76-5 |
| Literature: Bradsher; Swerlick Journal of the American Chemical Society, 1950 , vol. 72, p. 4189,4190 |
|
~%
2,4-diphenylben... CAS#:10468-76-5 |
| Literature: Bradsher; Swerlick Journal of the American Chemical Society, 1950 , vol. 72, p. 4189,4190 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| m-terphenyl-4'-carboxylic acid |
| 4'-Carboxy-m-terphenyl |
| m-Terphenyl-4'-carbonsaeure |