methyl 3-(2,4-diaminophenoxy)thiophene-2-carboxylate structure
|
Common Name | methyl 3-(2,4-diaminophenoxy)thiophene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 104636-77-3 | Molecular Weight | 264.30000 | |
| Density | 1.376g/cm3 | Boiling Point | 432.3ºC at 760mmHg | |
| Molecular Formula | C12H12N2O3S | Melting Point | 166-169ºC | |
| MSDS | N/A | Flash Point | 215.2ºC | |
| Name | methyl 3-(2,4-diaminophenoxy)thiophene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.376g/cm3 |
|---|---|
| Boiling Point | 432.3ºC at 760mmHg |
| Melting Point | 166-169ºC |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.30000 |
| Flash Point | 215.2ºC |
| Exact Mass | 264.05700 |
| PSA | 115.81000 |
| LogP | 3.65380 |
| Vapour Pressure | 1.12E-07mmHg at 25°C |
| Index of Refraction | 1.665 |
| InChIKey | BHYJCDZZCPONPJ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1sccc1Oc1ccc(N)cc1N |
| HS Code | 2934999090 |
|---|
|
~89%
methyl 3-(2,4-d... CAS#:104636-77-3 |
| Literature: Corral; Lissavetzky; Valdeolmillos Journal of Heterocyclic Chemistry, 1985 , vol. 22, # 5 p. 1349 - 1352 |
|
~%
methyl 3-(2,4-d... CAS#:104636-77-3 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 22, # 5 p. 1349 - 1352 |
|
~%
methyl 3-(2,4-d... CAS#:104636-77-3 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 22, # 5 p. 1349 - 1352 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Thiophenecarboxylicacid,3-(2,4-diaminophenoxy)-,methyl ester |
| methyl 3-(2,4-diaminophenoxy)-2-thiophenecarboxylate |