[2,6-dichloro-4-(trifluoromethylsulfonyl)phenyl]hydrazine structure
|
Common Name | [2,6-dichloro-4-(trifluoromethylsulfonyl)phenyl]hydrazine | ||
|---|---|---|---|---|
| CAS Number | 104614-74-6 | Molecular Weight | 309.09300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H5Cl2F3N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [2,6-dichloro-4-(trifluoromethylsulfonyl)phenyl]hydrazine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H5Cl2F3N2O2S |
|---|---|
| Molecular Weight | 309.09300 |
| Exact Mass | 307.94000 |
| PSA | 80.57000 |
| LogP | 4.42660 |
| InChIKey | MENZSUIQLCICJX-UHFFFAOYSA-N |
| SMILES | NNc1c(Cl)cc(S(=O)(=O)C(F)(F)F)cc1Cl |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2,6-Dichloro-4-(trifluoromethylsulfonyl)phenylhydrazine |
| 2,5-DIBROMO-3,6-DIFLUOROBENZEN |
| Hydrazine,[2,6-dichloro-4-[(trifluoromethyl)sulfonyl]phenyl] |