diethyl 2,2-bis(naphthalen-1-ylmethyl)propanedioate structure
|
Common Name | diethyl 2,2-bis(naphthalen-1-ylmethyl)propanedioate | ||
|---|---|---|---|---|
| CAS Number | 104539-18-6 | Molecular Weight | 440.53000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H28O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2,2-bis(naphthalen-1-ylmethyl)propanedioate |
|---|
| Molecular Formula | C29H28O4 |
|---|---|
| Molecular Weight | 440.53000 |
| Exact Mass | 440.19900 |
| PSA | 52.60000 |
| LogP | 5.89080 |
| InChIKey | LKJBFDRLQRRKRO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cc1cccc2ccccc12)(Cc1cccc2ccccc12)C(=O)OCC |
|
~75%
diethyl 2,2-bis... CAS#:104539-18-6 |
| Literature: Nishi, Takahide; Morisawa, Yasuhiro; Iijima, Yasuteru; Koike, Hiroyuki; Yabe, Yuichiro Journal of the Chemical Society, Chemical Communications, 1990 , # 23 p. 1672 - 1673 |
|
~%
diethyl 2,2-bis... CAS#:104539-18-6 |
| Literature: Valenta, Vladimir; Holubek, Jiri; Svatek, Emil; Miller, Vladimir; Vlkova, Marie; Protiva, Miroslav Collection of Czechoslovak Chemical Communications, 1987 , vol. 52, # 10 p. 2534 - 2544 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |