3,3-Diethyl-1-(pyridin-3-yl)azetidine-2,4-dione structure
|
Common Name | 3,3-Diethyl-1-(pyridin-3-yl)azetidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 104510-01-2 | Molecular Weight | 218.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3-Diethyl-1-(pyridin-3-yl)azetidine-2,4-dione |
|---|
| Molecular Formula | C12H14N2O2 |
|---|---|
| Molecular Weight | 218.25 |
| InChIKey | OHEZXQVPDSACCJ-UHFFFAOYSA-N |
| SMILES | CCC1(CC)C(=O)N(c2cccnc2)C1=O |
|
Name: Inhibition of human leukocyte elastase after 20 mins
Source: ChEMBL
Target: Neutrophil elastase
External Id: CHEMBL1045283
|
|
Name: Inhibition of human proteinase 3
Source: ChEMBL
Target: Myeloblastin
External Id: CHEMBL1047946
|
|
Name: Inhibition of human leukocyte elastase
Source: ChEMBL
Target: Neutrophil elastase
External Id: CHEMBL1047942
|