2-[(6-Hydroxy-2-naphthalenyl)oxy]acetic Acid structure
|
Common Name | 2-[(6-Hydroxy-2-naphthalenyl)oxy]acetic Acid | ||
|---|---|---|---|---|
| CAS Number | 10441-36-8 | Molecular Weight | 218.20500 | |
| Density | 1.388g/cm3 | Boiling Point | 458.4ºC at 760mmHg | |
| Molecular Formula | C12H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.7ºC | |
| Name | 2-[(6-Hydroxy-2-naphthalenyl)oxy]acetic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.388g/cm3 |
|---|---|
| Boiling Point | 458.4ºC at 760mmHg |
| Molecular Formula | C12H10O4 |
| Molecular Weight | 218.20500 |
| Flash Point | 184.7ºC |
| Exact Mass | 218.05800 |
| PSA | 66.76000 |
| LogP | 2.00880 |
| Vapour Pressure | 3.38E-09mmHg at 25°C |
| Index of Refraction | 1.672 |
| InChIKey | VTKLOBJSPNLFHC-UHFFFAOYSA-N |
| SMILES | O=C(O)COc1ccc2cc(O)ccc2c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(6-hydroxynaphthalen-2-yl)oxyacetic acid |