Dimethyl (2R,3R)-2,3-O-(1-Phenylethylidene)-L-tartrate
Modify Date: 2025-08-25 02:04:00
Dimethyl (2R,3R)-2,3-O-(1-Phenylethylidene)-L-tartrate structure
|
Common Name | Dimethyl (2R,3R)-2,3-O-(1-Phenylethylidene)-L-tartrate | ||
|---|---|---|---|---|
| CAS Number | 104333-83-7 | Molecular Weight | 280.27300 | |
| Density | 1.225g/cm3 | Boiling Point | 359.2ºC at 760 mmHg | |
| Molecular Formula | C14H16O6 | Melting Point | 54-58°C | |
| MSDS | N/A | Flash Point | 156.8ºC | |
| Name | (2r,3r)-2,3-o-(1-phenylethylidene)-l-tartaric acid dimethyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.225g/cm3 |
|---|---|
| Boiling Point | 359.2ºC at 760 mmHg |
| Melting Point | 54-58°C |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.27300 |
| Flash Point | 156.8ºC |
| Exact Mass | 280.09500 |
| PSA | 71.06000 |
| LogP | 0.98930 |
| Vapour Pressure | 2.42E-05mmHg at 25°C |
| Index of Refraction | 1.506 |
| InChIKey | XFSCUQFGXSPZCK-GHMZBOCLSA-N |
| SMILES | COC(=O)C1OC(C)(c2ccccc2)OC1C(=O)OC |
|
~61%
Dimethyl (2R,3R... CAS#:104333-83-7 |
| Literature: Minamikawa, Hiroyuki; Hayakawa, Satoshi; Yamada, Tohru; Iwasawa, Nobuharu; Narasaka, Koichi Bulletin of the Chemical Society of Japan, 1988 , vol. 61, # 12 p. 4379 - 4384 |
|
~%
Dimethyl (2R,3R... CAS#:104333-83-7 |
| Literature: Tetrahedron Asymmetry, , vol. 8, # 15 p. 2561 - 2570 |
![(+)-4,5-Bis[hydroxy(diphenyl)methyl]-2-methyl-2-phenyl-1,3-dioxolane structure](https://image.chemsrc.com/caspic/468/109306-21-0.png)
CAS#:109306-21-0| DiMethyl (2R,3R)-2,3-O-(1-Phenylethylidene)-L-tartrate |
| Dimethyl (4R,5R)-2-Methyl-2-phenyl-1,3-dioxolane-4,5-dicarboxylate |
| Phenylethylidenetartaricaciddimethylester |
| (2R,3R)-2,3-O-(1-Phenylethylidene)-L-tartaric Acid Dimethyl Ester |